C9H10N2O2S2 — CID 60681450
N-(1,3-benzothiazol-2-ylmethyl)methanesulfonamide (PubChem CID 60681450) has the molecular formula C9H10N2O2S2 and a molecular weight of 242.32 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-ylmethyl)methanesulfonamide.
| Compound Name | N-(1,3-benzothiazol-2-ylmethyl)methanesulfonamide |
|---|---|
| PubChem CID | 60681450 |
| Molecular Formula | C9H10N2O2S2 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.02 |
| IUPAC Name | N-(1,3-benzothiazol-2-ylmethyl)methanesulfonamide |
| SMILES | CS(=O)(=O)NCc1nc2ccccc2s1 |
| InChI | InChI=1S/C9H10N2O2S2/c1-15(12,13)10-6-9-11-7-4-2-3-5-8(7)14-9/h2-5,10H,6H2,1H3 |
| InChIKey | SWCOFMGWCQOYPC-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |