C14H10Cl2N2O2S2 — CID 32944413
N-(1,3-benzothiazol-2-ylmethyl)-2,3-dichlorobenzenesulfonamide (PubChem CID 32944413) has the molecular formula C14H10Cl2N2O2S2 and a molecular weight of 373.29 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-ylmethyl)-2,3-dichlorobenzenesulfonamide.
| Compound Name | N-(1,3-benzothiazol-2-ylmethyl)-2,3-dichlorobenzenesulfonamide |
|---|---|
| PubChem CID | 32944413 |
| Molecular Formula | C14H10Cl2N2O2S2 |
| Molecular Weight | 373.29 g/mol |
| Exact Mass | 371.96 |
| IUPAC Name | N-(1,3-benzothiazol-2-ylmethyl)-2,3-dichlorobenzenesulfonamide |
| SMILES | O=S(=O)(NCc1nc2ccccc2s1)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C14H10Cl2N2O2S2/c15-9-4-3-7-12(14(9)16)22(19,20)17-8-13-18-10-5-1-2-6-11(10)21-13/h1-7,17H,8H2 |
| InChIKey | SWNWAKMPJBDJSD-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.29 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |