C17H15Cl2N3O2S2 — CID 32678883
2-[4-(2,3-dichlorophenyl)sulfonylpiperazin-1-yl]-1,3-benzothiazole (PubChem CID 32678883) has the molecular formula C17H15Cl2N3O2S2 and a molecular weight of 428.37 g/mol. Its IUPAC name is 2-[4-(2,3-dichlorophenyl)sulfonylpiperazin-1-yl]-1,3-benzothiazole.
| Compound Name | 2-[4-(2,3-dichlorophenyl)sulfonylpiperazin-1-yl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 32678883 |
| Molecular Formula | C17H15Cl2N3O2S2 |
| Molecular Weight | 428.37 g/mol |
| Exact Mass | 427.00 |
| IUPAC Name | 2-[4-(2,3-dichlorophenyl)sulfonylpiperazin-1-yl]-1,3-benzothiazole |
| SMILES | O=S(=O)(c1cccc(Cl)c1Cl)N1CCN(c2nc3ccccc3s2)CC1 |
| InChI | InChI=1S/C17H15Cl2N3O2S2/c18-12-4-3-7-15(16(12)19)26(23,24)22-10-8-21(9-11-22)17-20-13-5-1-2-6-14(13)25-17/h1-7H,8-11H2 |
| InChIKey | JMRZXMXLXLAFLJ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.37 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |