C15H14ClN3O2S3 — CID 16937994
4-chloro-2-(4-thiophen-2-ylsulfonylpiperazin-1-yl)-1,3-benzothiazole (PubChem CID 16937994) has the molecular formula C15H14ClN3O2S3 and a molecular weight of 399.95 g/mol. Its IUPAC name is 4-chloro-2-(4-thiophen-2-ylsulfonylpiperazin-1-yl)-1,3-benzothiazole.
| Compound Name | 4-chloro-2-(4-thiophen-2-ylsulfonylpiperazin-1-yl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 16937994 |
| Molecular Formula | C15H14ClN3O2S3 |
| Molecular Weight | 399.95 g/mol |
| Exact Mass | 398.99 |
| IUPAC Name | 4-chloro-2-(4-thiophen-2-ylsulfonylpiperazin-1-yl)-1,3-benzothiazole |
| SMILES | O=S(=O)(c1cccs1)N1CCN(c2nc3c(Cl)cccc3s2)CC1 |
| InChI | InChI=1S/C15H14ClN3O2S3/c16-11-3-1-4-12-14(11)17-15(23-12)18-6-8-19(9-7-18)24(20,21)13-5-2-10-22-13/h1-5,10H,6-9H2 |
| InChIKey | JNKBDWISPKKVTA-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.95 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |