C14H11ClN2S — CID 60671297
N-(1,3-benzothiazol-2-ylmethyl)-3-chloroaniline (PubChem CID 60671297) has the molecular formula C14H11ClN2S and a molecular weight of 274.78 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-ylmethyl)-3-chloroaniline.
| Compound Name | N-(1,3-benzothiazol-2-ylmethyl)-3-chloroaniline |
|---|---|
| PubChem CID | 60671297 |
| Molecular Formula | C14H11ClN2S |
| Molecular Weight | 274.78 g/mol |
| Exact Mass | 274.03 |
| IUPAC Name | N-(1,3-benzothiazol-2-ylmethyl)-3-chloroaniline |
| SMILES | Clc1cccc(NCc2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C14H11ClN2S/c15-10-4-3-5-11(8-10)16-9-14-17-12-6-1-2-7-13(12)18-14/h1-8,16H,9H2 |
| InChIKey | UASHEJVJWOEILM-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.78 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |