C15H13ClN2OS — CID 79511098
3-chloro-N-[(6-methoxy-1,3-benzothiazol-2-yl)methyl]aniline (PubChem CID 79511098) has the molecular formula C15H13ClN2OS and a molecular weight of 304.80 g/mol. Its IUPAC name is 3-chloro-N-[(6-methoxy-1,3-benzothiazol-2-yl)methyl]aniline.
| Compound Name | 3-chloro-N-[(6-methoxy-1,3-benzothiazol-2-yl)methyl]aniline |
|---|---|
| PubChem CID | 79511098 |
| Molecular Formula | C15H13ClN2OS |
| Molecular Weight | 304.80 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | 3-chloro-N-[(6-methoxy-1,3-benzothiazol-2-yl)methyl]aniline |
| SMILES | COc1ccc2nc(CNc3cccc(Cl)c3)sc2c1 |
| InChI | InChI=1S/C15H13ClN2OS/c1-19-12-5-6-13-14(8-12)20-15(18-13)9-17-11-4-2-3-10(16)7-11/h2-8,17H,9H2,1H3 |
| InChIKey | DKSIPXXCPNWPAZ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.80 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |