C15H13FN2OS — CID 114839332
N-(1,3-benzothiazol-2-ylmethyl)-4-fluoro-3-methoxyaniline (PubChem CID 114839332) has the molecular formula C15H13FN2OS and a molecular weight of 288.35 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-ylmethyl)-4-fluoro-3-methoxyaniline.
| Compound Name | N-(1,3-benzothiazol-2-ylmethyl)-4-fluoro-3-methoxyaniline |
|---|---|
| PubChem CID | 114839332 |
| Molecular Formula | C15H13FN2OS |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | N-(1,3-benzothiazol-2-ylmethyl)-4-fluoro-3-methoxyaniline |
| SMILES | COc1cc(NCc2nc3ccccc3s2)ccc1F |
| InChI | InChI=1S/C15H13FN2OS/c1-19-13-8-10(6-7-11(13)16)17-9-15-18-12-4-2-3-5-14(12)20-15/h2-8,17H,9H2,1H3 |
| InChIKey | VYBHEMRYQOJSBM-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |