C16H12Cl2N2OS — CID 2557871
N-(1,3-benzothiazol-2-ylmethyl)-2-(2,6-dichlorophenyl)acetamide (PubChem CID 2557871) has the molecular formula C16H12Cl2N2OS and a molecular weight of 351.26 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-ylmethyl)-2-(2,6-dichlorophenyl)acetamide.
| Compound Name | N-(1,3-benzothiazol-2-ylmethyl)-2-(2,6-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 2557871 |
| Molecular Formula | C16H12Cl2N2OS |
| Molecular Weight | 351.26 g/mol |
| Exact Mass | 350.00 |
| IUPAC Name | N-(1,3-benzothiazol-2-ylmethyl)-2-(2,6-dichlorophenyl)acetamide |
| SMILES | O=C(Cc1c(Cl)cccc1Cl)NCc1nc2ccccc2s1 |
| InChI | InChI=1S/C16H12Cl2N2OS/c17-11-4-3-5-12(18)10(11)8-15(21)19-9-16-20-13-6-1-2-7-14(13)22-16/h1-7H,8-9H2,(H,19,21) |
| InChIKey | GVGHVABBUIYYMD-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.26 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |