C18H17NO2S — CID 78761188
1-phenylethyl 3-(1,3-benzothiazol-2-yl)propanoate (PubChem CID 78761188) has the molecular formula C18H17NO2S and a molecular weight of 311.41 g/mol. Its IUPAC name is 1-phenylethyl 3-(1,3-benzothiazol-2-yl)propanoate.
| Compound Name | 1-phenylethyl 3-(1,3-benzothiazol-2-yl)propanoate |
|---|---|
| PubChem CID | 78761188 |
| Molecular Formula | C18H17NO2S |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | 1-phenylethyl 3-(1,3-benzothiazol-2-yl)propanoate |
| SMILES | CC(OC(=O)CCc1nc2ccccc2s1)c1ccccc1 |
| InChI | InChI=1S/C18H17NO2S/c1-13(14-7-3-2-4-8-14)21-18(20)12-11-17-19-15-9-5-6-10-16(15)22-17/h2-10,13H,11-12H2,1H3 |
| InChIKey | AOOUDGYBTYDHCV-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |