C38H47NO4S — CID 57160380
bis[1-(4-propylphenyl)ethyl] 2-[4-(1,3-benzothiazol-2-yl)butyl]pentanedioate (PubChem CID 57160380) has the molecular formula C38H47NO4S and a molecular weight of 613.86 g/mol. Its IUPAC name is bis[1-(4-propylphenyl)ethyl] 2-[4-(1,3-benzothiazol-2-yl)butyl]pentanedioate.
| Compound Name | bis[1-(4-propylphenyl)ethyl] 2-[4-(1,3-benzothiazol-2-yl)butyl]pentanedioate |
|---|---|
| PubChem CID | 57160380 |
| Molecular Formula | C38H47NO4S |
| Molecular Weight | 613.86 g/mol |
| Exact Mass | 613.32 |
| IUPAC Name | bis[1-(4-propylphenyl)ethyl] 2-[4-(1,3-benzothiazol-2-yl)butyl]pentanedioate |
| SMILES | CCCc1ccc(C(C)OC(=O)CCC(CCCCc2nc3ccccc3s2)C(=O)OC(C)c2ccc(CCC)cc2)cc1 |
| InChI | InChI=1S/C38H47NO4S/c1-5-11-29-17-21-31(22-18-29)27(3)42-37(40)26-25-33(13-7-10-16-36-39-34-14-8-9-15-35(34)44-36)38(41)43-28(4)32-23-19-30(12-6-2)20-24-32/h8-9,14-15,17-24,27-28,33H,5-7,10-13,16,25-26H2,1-4H3 |
| InChIKey | AYIYFKHCGJFTMM-UHFFFAOYSA-N |
| XLogP | 9.92 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.86 |
| LogP ≤ 5 | 9.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|