About bis[1-(4-propylphenyl)ethyl] 2-[4-(1,3-benzoxazol-2-yl)butyl]pentanedioate
bis[1-(4-propylphenyl)ethyl] 2-[4-(1,3-benzoxazol-2-yl)butyl]pentanedioate (PubChem CID 90715344) has the molecular formula C38H47NO5
and a molecular weight of 597.80 g/mol. Its IUPAC name is bis[1-(4-propylphenyl)ethyl] 2-[4-(1,3-benzoxazol-2-yl)butyl]pentanedioate.
Molecular Properties
| Compound Name | bis[1-(4-propylphenyl)ethyl] 2-[4-(1,3-benzoxazol-2-yl)butyl]pentanedioate |
| PubChem CID | 90715344 |
| Molecular Formula | C38H47NO5 |
| Molecular Weight | 597.80 g/mol |
| Exact Mass | 597.35 |
| IUPAC Name | bis[1-(4-propylphenyl)ethyl] 2-[4-(1,3-benzoxazol-2-yl)butyl]pentanedioate |
| SMILES | CCCc1ccc(C(C)OC(=O)CCC(CCCCc2nc3ccccc3o2)C(=O)OC(C)c2ccc(CCC)cc2)cc1 |
| InChI | InChI=1S/C38H47NO5/c1-5-11-29-17-21-31(22-18-29)27(3)42-37(40)26-25-33(13-7-10-16-36-39-34-14-8-9-15-35(34)44-36)38(41)43-28(4)32-23-19-30(12-6-2)20-24-32/h8-9,14-15,17-24,27-28,33H,5-7,10-13,16,25-26H2,1-4H3 |
| InChIKey | FKZDEDAFZQXMOQ-UHFFFAOYSA-N |
| XLogP | 9.45 |
| TPSA | 78.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 597.80 |
| LogP ≤ 5 | 9.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze bis[1-(4-propylphenyl)ethyl] 2-[4-(1,3-benzoxazol-2-yl)butyl]pentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[1-(4-propylphenyl)ethyl] 2-[4-(1,3-benzoxazol-2-yl)butyl]pentanedioate?
The IUPAC name of bis[1-(4-propylphenyl)ethyl] 2-[4-(1,3-benzoxazol-2-yl)butyl]pentanedioate (CID 90715344) is bis[1-(4-propylphenyl)ethyl] 2-[4-(1,3-benzoxazol-2-yl)butyl]pentanedioate.
What is the SMILES notation for bis[1-(4-propylphenyl)ethyl] 2-[4-(1,3-benzoxazol-2-yl)butyl]pentanedioate?
The canonical SMILES for bis[1-(4-propylphenyl)ethyl] 2-[4-(1,3-benzoxazol-2-yl)butyl]pentanedioate is CCCc1ccc(C(C)OC(=O)CCC(CCCCc2nc3ccccc3o2)C(=O)OC(C)c2ccc(CCC)cc2)cc1.
What is the InChIKey of bis[1-(4-propylphenyl)ethyl] 2-[4-(1,3-benzoxazol-2-yl)butyl]pentanedioate?
The InChIKey is FKZDEDAFZQXMOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C38H47NO5/c1-5-11-29-17-21-31(22-18-29)27(3)42-37(40)26-25-33(13-7-10-16-36-39-34-14-8-9-15-35(34)44-36)38(41)43-28(4)32-23-19-30(12-6-2)20-24-32/h8-9,14-15,17-24,27-28,33H,5-7,10-13,16,25-26H2,1-4H3.
What are the key properties of bis[1-(4-propylphenyl)ethyl] 2-[4-(1,3-benzoxazol-2-yl)butyl]pentanedioate?
bis[1-(4-propylphenyl)ethyl] 2-[4-(1,3-benzoxazol-2-yl)butyl]pentanedioate has a molecular weight of 597.80 g/mol, XLogP of 9.45, 17 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis[1-(4-propylphenyl)ethyl] 2-[4-(1,3-benzoxazol-2-yl)butyl]pentanedioate is sourced from PubChem (CID 90715344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).