C17H23N3O2S — CID 9470642
5-(1,3-benzothiazol-2-yl)-N-[(2R)-1-(ethylamino)-1-oxopropan-2-yl]pentanamide (PubChem CID 9470642) has the molecular formula C17H23N3O2S and a molecular weight of 333.46 g/mol. Its IUPAC name is 5-(1,3-benzothiazol-2-yl)-N-[(2R)-1-(ethylamino)-1-oxopropan-2-yl]pentanamide.
| Compound Name | 5-(1,3-benzothiazol-2-yl)-N-[(2R)-1-(ethylamino)-1-oxopropan-2-yl]pentanamide |
|---|---|
| PubChem CID | 9470642 |
| Molecular Formula | C17H23N3O2S |
| Molecular Weight | 333.46 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | 5-(1,3-benzothiazol-2-yl)-N-[(2R)-1-(ethylamino)-1-oxopropan-2-yl]pentanamide |
| SMILES | CCNC(=O)[C@@H](C)NC(=O)CCCCc1nc2ccccc2s1 |
| InChI | InChI=1S/C17H23N3O2S/c1-3-18-17(22)12(2)19-15(21)10-6-7-11-16-20-13-8-4-5-9-14(13)23-16/h4-5,8-9,12H,3,6-7,10-11H2,1-2H3,(H,18,22)(H,19,21)/t12-/m1/s1 |
| InChIKey | KVNNPGAOZYAHGG-GFCCVEGCSA-N |
| XLogP | 2.65 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.46 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|