C21H22N2O3S — CID 55320336
[1-(benzylamino)-1-oxopropan-2-yl] 4-(1,3-benzothiazol-2-yl)butanoate (PubChem CID 55320336) has the molecular formula C21H22N2O3S and a molecular weight of 382.49 g/mol. Its IUPAC name is [1-(benzylamino)-1-oxopropan-2-yl] 4-(1,3-benzothiazol-2-yl)butanoate.
| Compound Name | [1-(benzylamino)-1-oxopropan-2-yl] 4-(1,3-benzothiazol-2-yl)butanoate |
|---|---|
| PubChem CID | 55320336 |
| Molecular Formula | C21H22N2O3S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | [1-(benzylamino)-1-oxopropan-2-yl] 4-(1,3-benzothiazol-2-yl)butanoate |
| SMILES | CC(OC(=O)CCCc1nc2ccccc2s1)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C21H22N2O3S/c1-15(21(25)22-14-16-8-3-2-4-9-16)26-20(24)13-7-12-19-23-17-10-5-6-11-18(17)27-19/h2-6,8-11,15H,7,12-14H2,1H3,(H,22,25) |
| InChIKey | NAXUGMPOVQEWHX-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |