C12H12NNaO3S2 — CID 173407496
sodium;hydride;methyl 4-(1,3-benzothiazol-2-ylsulfanyl)-4-oxobutanoate (PubChem CID 173407496) has the molecular formula C12H12NNaO3S2 and a molecular weight of 305.36 g/mol. Its IUPAC name is sodium;hydride;methyl 4-(1,3-benzothiazol-2-ylsulfanyl)-4-oxobutanoate.
| Compound Name | sodium;hydride;methyl 4-(1,3-benzothiazol-2-ylsulfanyl)-4-oxobutanoate |
|---|---|
| PubChem CID | 173407496 |
| Molecular Formula | C12H12NNaO3S2 |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.02 |
| IUPAC Name | sodium;hydride;methyl 4-(1,3-benzothiazol-2-ylsulfanyl)-4-oxobutanoate |
| SMILES | COC(=O)CCC(=O)Sc1nc2ccccc2s1.[H-].[Na+] |
| InChI | InChI=1S/C12H11NO3S2.Na.H/c1-16-10(14)6-7-11(15)18-12-13-8-4-2-3-5-9(8)17-12;;/h2-5H,6-7H2,1H3;;/q;+1;-1 |
| InChIKey | GYESIKBJYZVQBR-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|