C13H11NO4S2 — CID 70492967
dimethyl 2-(1,3-benzothiazol-2-ylsulfanyl)but-2-enedioate (PubChem CID 70492967) has the molecular formula C13H11NO4S2 and a molecular weight of 309.37 g/mol. Its IUPAC name is dimethyl 2-(1,3-benzothiazol-2-ylsulfanyl)but-2-enedioate.
| Compound Name | dimethyl 2-(1,3-benzothiazol-2-ylsulfanyl)but-2-enedioate |
|---|---|
| PubChem CID | 70492967 |
| Molecular Formula | C13H11NO4S2 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.01 |
| IUPAC Name | dimethyl 2-(1,3-benzothiazol-2-ylsulfanyl)but-2-enedioate |
| SMILES | COC(=O)C=C(Sc1nc2ccccc2s1)C(=O)OC |
| InChI | InChI=1S/C13H11NO4S2/c1-17-11(15)7-10(12(16)18-2)20-13-14-8-5-3-4-6-9(8)19-13/h3-7H,1-2H3 |
| InChIKey | VURPYCYSBIUFEA-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|