C17H15N3O2S2 — CID 53242492
1,3-benzothiazol-2-yl (1Z)-N-(4-methoxyanilino)-2-oxopropanimidothioate (PubChem CID 53242492) has the molecular formula C17H15N3O2S2 and a molecular weight of 357.46 g/mol. Its IUPAC name is 1,3-benzothiazol-2-yl (1Z)-N-(4-methoxyanilino)-2-oxopropanimidothioate.
| Compound Name | 1,3-benzothiazol-2-yl (1Z)-N-(4-methoxyanilino)-2-oxopropanimidothioate |
|---|---|
| PubChem CID | 53242492 |
| Molecular Formula | C17H15N3O2S2 |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | 1,3-benzothiazol-2-yl (1Z)-N-(4-methoxyanilino)-2-oxopropanimidothioate |
| SMILES | COc1ccc(N/N=C(\Sc2nc3ccccc3s2)C(C)=O)cc1 |
| InChI | InChI=1S/C17H15N3O2S2/c1-11(21)16(20-19-12-7-9-13(22-2)10-8-12)24-17-18-14-5-3-4-6-15(14)23-17/h3-10,19H,1-2H3/b20-16- |
| InChIKey | JCRLHWMOKPQOPE-SILNSSARSA-N |
| XLogP | 4.41 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|