C17H14ClN3O2S2 — CID 6323820
ethyl (2Z)-2-(1,3-benzothiazol-2-ylsulfanyl)-2-[(2-chlorophenyl)hydrazinylidene]acetate (PubChem CID 6323820) has the molecular formula C17H14ClN3O2S2 and a molecular weight of 391.91 g/mol. Its IUPAC name is ethyl (2Z)-2-(1,3-benzothiazol-2-ylsulfanyl)-2-[(2-chlorophenyl)hydrazinylidene]acetate.
| Compound Name | ethyl (2Z)-2-(1,3-benzothiazol-2-ylsulfanyl)-2-[(2-chlorophenyl)hydrazinylidene]acetate |
|---|---|
| PubChem CID | 6323820 |
| Molecular Formula | C17H14ClN3O2S2 |
| Molecular Weight | 391.91 g/mol |
| Exact Mass | 391.02 |
| IUPAC Name | ethyl (2Z)-2-(1,3-benzothiazol-2-ylsulfanyl)-2-[(2-chlorophenyl)hydrazinylidene]acetate |
| SMILES | CCOC(=O)/C(=N/Nc1ccccc1Cl)Sc1nc2ccccc2s1 |
| InChI | InChI=1S/C17H14ClN3O2S2/c1-2-23-16(22)15(21-20-12-8-4-3-7-11(12)18)25-17-19-13-9-5-6-10-14(13)24-17/h3-10,20H,2H2,1H3/b21-15- |
| InChIKey | LXHJNPWQNUHRPW-QNGOZBTKSA-N |
| XLogP | 5.03 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.91 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|