C21H15NO2S2 — CID 5170537
S-(1,3-benzothiazol-2-yl) 3-(4-methoxyphenyl)benzenecarbothioate (PubChem CID 5170537) has the molecular formula C21H15NO2S2 and a molecular weight of 377.49 g/mol. Its IUPAC name is S-(1,3-benzothiazol-2-yl) 3-(4-methoxyphenyl)benzenecarbothioate.
| Compound Name | S-(1,3-benzothiazol-2-yl) 3-(4-methoxyphenyl)benzenecarbothioate |
|---|---|
| PubChem CID | 5170537 |
| Molecular Formula | C21H15NO2S2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.05 |
| IUPAC Name | S-(1,3-benzothiazol-2-yl) 3-(4-methoxyphenyl)benzenecarbothioate |
| SMILES | COc1ccc(-c2cccc(C(=O)Sc3nc4ccccc4s3)c2)cc1 |
| InChI | InChI=1S/C21H15NO2S2/c1-24-17-11-9-14(10-12-17)15-5-4-6-16(13-15)20(23)26-21-22-18-7-2-3-8-19(18)25-21/h2-13H,1H3 |
| InChIKey | QGZYULWXHLYVBI-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|