C18H17N5OS — CID 7098721
(E)-N-(1,3-benzothiazol-2-ylimino)-N'-(4-methoxyanilino)but-2-enimidamide (PubChem CID 7098721) has the molecular formula C18H17N5OS and a molecular weight of 351.44 g/mol. Its IUPAC name is (E)-N-(1,3-benzothiazol-2-ylimino)-N'-(4-methoxyanilino)but-2-enimidamide.
| Compound Name | (E)-N-(1,3-benzothiazol-2-ylimino)-N'-(4-methoxyanilino)but-2-enimidamide |
|---|---|
| PubChem CID | 7098721 |
| Molecular Formula | C18H17N5OS |
| Molecular Weight | 351.44 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | (E)-N-(1,3-benzothiazol-2-ylimino)-N'-(4-methoxyanilino)but-2-enimidamide |
| SMILES | C/C=C/C(=NNc1ccc(OC)cc1)/N=N/c1nc2ccccc2s1 |
| InChI | InChI=1S/C18H17N5OS/c1-3-6-17(21-20-13-9-11-14(24-2)12-10-13)22-23-18-19-15-7-4-5-8-16(15)25-18/h3-12,20H,1-2H3/b6-3+,21-17?,23-22+ |
| InChIKey | INHBOXBOKQCOEC-QSYZZIIUSA-N |
| XLogP | 5.39 |
| TPSA | 71.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.44 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|