C20H14ClN5S — CID 5024032
N-(1,3-benzothiazol-2-ylimino)-N'-(2-chloroanilino)benzenecarboximidamide (PubChem CID 5024032) has the molecular formula C20H14ClN5S and a molecular weight of 391.89 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-ylimino)-N'-(2-chloroanilino)benzenecarboximidamide.
| Compound Name | N-(1,3-benzothiazol-2-ylimino)-N'-(2-chloroanilino)benzenecarboximidamide |
|---|---|
| PubChem CID | 5024032 |
| Molecular Formula | C20H14ClN5S |
| Molecular Weight | 391.89 g/mol |
| Exact Mass | 391.07 |
| IUPAC Name | N-(1,3-benzothiazol-2-ylimino)-N'-(2-chloroanilino)benzenecarboximidamide |
| SMILES | Clc1ccccc1NN=C(/N=N/c1nc2ccccc2s1)c1ccccc1 |
| InChI | InChI=1S/C20H14ClN5S/c21-15-10-4-5-11-16(15)23-24-19(14-8-2-1-3-9-14)25-26-20-22-17-12-6-7-13-18(17)27-20/h1-13,23H/b24-19?,26-25+ |
| InChIKey | GQDJHWHUEKQYLR-DBQCWECDSA-N |
| XLogP | 6.51 |
| TPSA | 62.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.89 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|