C20H15N5OS — CID 177407947
N'-anilino-N-(1,3-benzothiazol-2-ylimino)-2-hydroxybenzenecarboximidamide (PubChem CID 177407947) has the molecular formula C20H15N5OS and a molecular weight of 373.44 g/mol. Its IUPAC name is N'-anilino-N-(1,3-benzothiazol-2-ylimino)-2-hydroxybenzenecarboximidamide.
| Compound Name | N'-anilino-N-(1,3-benzothiazol-2-ylimino)-2-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 177407947 |
| Molecular Formula | C20H15N5OS |
| Molecular Weight | 373.44 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | N'-anilino-N-(1,3-benzothiazol-2-ylimino)-2-hydroxybenzenecarboximidamide |
| SMILES | Oc1ccccc1C(=N/Nc1ccccc1)/N=N/c1nc2ccccc2s1 |
| InChI | InChI=1S/C20H15N5OS/c26-17-12-6-4-10-15(17)19(23-22-14-8-2-1-3-9-14)24-25-20-21-16-11-5-7-13-18(16)27-20/h1-13,22,26H/b23-19-,25-24+ |
| InChIKey | HVAXMWPLCYJCRA-WSESLVOBSA-N |
| XLogP | 5.56 |
| TPSA | 82.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.44 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|