C19H15N5OS2 — CID 170458742
N-(1,3-benzothiazol-2-ylimino)-N'-(4-methoxyanilino)thiophene-2-carboximidamide (PubChem CID 170458742) has the molecular formula C19H15N5OS2 and a molecular weight of 393.50 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-ylimino)-N'-(4-methoxyanilino)thiophene-2-carboximidamide.
| Compound Name | N-(1,3-benzothiazol-2-ylimino)-N'-(4-methoxyanilino)thiophene-2-carboximidamide |
|---|---|
| PubChem CID | 170458742 |
| Molecular Formula | C19H15N5OS2 |
| Molecular Weight | 393.50 g/mol |
| Exact Mass | 393.07 |
| IUPAC Name | N-(1,3-benzothiazol-2-ylimino)-N'-(4-methoxyanilino)thiophene-2-carboximidamide |
| SMILES | COc1ccc(NN=C(/N=N/c2nc3ccccc3s2)c2cccs2)cc1 |
| InChI | InChI=1S/C19H15N5OS2/c1-25-14-10-8-13(9-11-14)21-22-18(17-7-4-12-26-17)23-24-19-20-15-5-2-3-6-16(15)27-19/h2-12,21H,1H3/b22-18?,24-23+ |
| InChIKey | FEJNQHHGANFTMO-DYYCZBJJSA-N |
| XLogP | 5.92 |
| TPSA | 71.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.50 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|