C22H19N3OS — CID 56730349
N'-(6-methoxy-1,3-benzothiazol-2-yl)-N-(4-methylphenyl)benzenecarboximidamide (PubChem CID 56730349) has the molecular formula C22H19N3OS and a molecular weight of 373.48 g/mol. Its IUPAC name is N'-(6-methoxy-1,3-benzothiazol-2-yl)-N-(4-methylphenyl)benzenecarboximidamide.
| Compound Name | N'-(6-methoxy-1,3-benzothiazol-2-yl)-N-(4-methylphenyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 56730349 |
| Molecular Formula | C22H19N3OS |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | N'-(6-methoxy-1,3-benzothiazol-2-yl)-N-(4-methylphenyl)benzenecarboximidamide |
| SMILES | COc1ccc2nc(/N=C(/Nc3ccc(C)cc3)c3ccccc3)sc2c1 |
| InChI | InChI=1S/C22H19N3OS/c1-15-8-10-17(11-9-15)23-21(16-6-4-3-5-7-16)25-22-24-19-13-12-18(26-2)14-20(19)27-22/h3-14H,1-2H3,(H,23,24,25) |
| InChIKey | QTYLFTDNWGYQCL-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 46.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|