C18H13N3O2S — CID 2311776
1-[(6-methoxy-1,3-benzothiazol-2-yl)diazenyl]naphthalen-2-ol (PubChem CID 2311776) has the molecular formula C18H13N3O2S and a molecular weight of 335.39 g/mol. Its IUPAC name is 1-[(6-methoxy-1,3-benzothiazol-2-yl)diazenyl]naphthalen-2-ol.
| Compound Name | 1-[(6-methoxy-1,3-benzothiazol-2-yl)diazenyl]naphthalen-2-ol |
|---|---|
| PubChem CID | 2311776 |
| Molecular Formula | C18H13N3O2S |
| Molecular Weight | 335.39 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | 1-[(6-methoxy-1,3-benzothiazol-2-yl)diazenyl]naphthalen-2-ol |
| SMILES | COc1ccc2nc(/N=N/c3c(O)ccc4ccccc34)sc2c1 |
| InChI | InChI=1S/C18H13N3O2S/c1-23-12-7-8-14-16(10-12)24-18(19-14)21-20-17-13-5-3-2-4-11(13)6-9-15(17)22/h2-10,22H,1H3/b21-20+ |
| InChIKey | MPIBXZYNRVPXKA-QZQOTICOSA-N |
| XLogP | 5.58 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.39 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|