C20H15N3OS — CID 137185564
1-[(5-benzyl-1,3-thiazol-2-yl)diazenyl]naphthalen-2-ol (PubChem CID 137185564) has the molecular formula C20H15N3OS and a molecular weight of 345.43 g/mol. Its IUPAC name is 1-[(5-benzyl-1,3-thiazol-2-yl)diazenyl]naphthalen-2-ol.
| Compound Name | 1-[(5-benzyl-1,3-thiazol-2-yl)diazenyl]naphthalen-2-ol |
|---|---|
| PubChem CID | 137185564 |
| Molecular Formula | C20H15N3OS |
| Molecular Weight | 345.43 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | 1-[(5-benzyl-1,3-thiazol-2-yl)diazenyl]naphthalen-2-ol |
| SMILES | Oc1ccc2ccccc2c1/N=N/c1ncc(Cc2ccccc2)s1 |
| InChI | InChI=1S/C20H15N3OS/c24-18-11-10-15-8-4-5-9-17(15)19(18)22-23-20-21-13-16(25-20)12-14-6-2-1-3-7-14/h1-11,13,24H,12H2/b23-22+ |
| InChIKey | YPRIUKFEOWDWIY-GHVJWSGMSA-N |
| XLogP | 6.01 |
| TPSA | 57.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.43 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|