C13H12N6O — CID 135418326
1-[(3,5-diamino-1H-pyrazol-4-yl)diazenyl]naphthalen-2-ol (PubChem CID 135418326) has the molecular formula C13H12N6O and a molecular weight of 268.28 g/mol. Its IUPAC name is 1-[(3,5-diamino-1H-pyrazol-4-yl)diazenyl]naphthalen-2-ol.
| Compound Name | 1-[(3,5-diamino-1H-pyrazol-4-yl)diazenyl]naphthalen-2-ol |
|---|---|
| PubChem CID | 135418326 |
| Molecular Formula | C13H12N6O |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 1-[(3,5-diamino-1H-pyrazol-4-yl)diazenyl]naphthalen-2-ol |
| SMILES | Nc1n[nH]c(N)c1/N=N/c1c(O)ccc2ccccc12 |
| InChI | InChI=1S/C13H12N6O/c14-12-11(13(15)19-18-12)17-16-10-8-4-2-1-3-7(8)5-6-9(10)20/h1-6,20H,(H5,14,15,18,19)/b17-16+ |
| InChIKey | GDXYBJKEXPHAJF-WUKNDPDISA-N |
| XLogP | 2.85 |
| TPSA | 125.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|