C20H14N2O5S — CID 136595298
3-hydroxy-2-[(2-hydroxynaphthalen-1-yl)diazenyl]naphthalene-1-sulfonic acid (PubChem CID 136595298) has the molecular formula C20H14N2O5S and a molecular weight of 394.41 g/mol. Its IUPAC name is 3-hydroxy-2-[(2-hydroxynaphthalen-1-yl)diazenyl]naphthalene-1-sulfonic acid.
| Compound Name | 3-hydroxy-2-[(2-hydroxynaphthalen-1-yl)diazenyl]naphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 136595298 |
| Molecular Formula | C20H14N2O5S |
| Molecular Weight | 394.41 g/mol |
| Exact Mass | 394.06 |
| IUPAC Name | 3-hydroxy-2-[(2-hydroxynaphthalen-1-yl)diazenyl]naphthalene-1-sulfonic acid |
| SMILES | O=S(=O)(O)c1c(/N=N/c2c(O)ccc3ccccc23)c(O)cc2ccccc12 |
| InChI | InChI=1S/C20H14N2O5S/c23-16-10-9-12-5-1-3-7-14(12)18(16)21-22-19-17(24)11-13-6-2-4-8-15(13)20(19)28(25,26)27/h1-11,23-24H,(H,25,26,27)/b22-21+ |
| InChIKey | DDDLRRUCKKRXNO-QURGRASLSA-N |
| XLogP | 5.07 |
| TPSA | 119.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.41 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|