C16H10Cl2N2O2 — CID 135727362
1-[(2,4-dichloro-6-hydroxyphenyl)diazenyl]naphthalen-2-ol (PubChem CID 135727362) has the molecular formula C16H10Cl2N2O2 and a molecular weight of 333.17 g/mol. Its IUPAC name is 1-[(2,4-dichloro-6-hydroxyphenyl)diazenyl]naphthalen-2-ol.
| Compound Name | 1-[(2,4-dichloro-6-hydroxyphenyl)diazenyl]naphthalen-2-ol |
|---|---|
| PubChem CID | 135727362 |
| Molecular Formula | C16H10Cl2N2O2 |
| Molecular Weight | 333.17 g/mol |
| Exact Mass | 332.01 |
| IUPAC Name | 1-[(2,4-dichloro-6-hydroxyphenyl)diazenyl]naphthalen-2-ol |
| SMILES | Oc1cc(Cl)cc(Cl)c1/N=N/c1c(O)ccc2ccccc12 |
| InChI | InChI=1S/C16H10Cl2N2O2/c17-10-7-12(18)16(14(22)8-10)20-19-15-11-4-2-1-3-9(11)5-6-13(15)21/h1-8,21-22H/b20-19+ |
| InChIKey | HGLYCWPKNOMMCL-FMQUCBEESA-N |
| XLogP | 5.97 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.17 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|