C26H24N4O — CID 135977813
1-[(2,3,5,6-tetramethyl-4-phenyldiazenylphenyl)diazenyl]naphthalen-2-ol (PubChem CID 135977813) has the molecular formula C26H24N4O and a molecular weight of 408.50 g/mol. Its IUPAC name is 1-[(2,3,5,6-tetramethyl-4-phenyldiazenylphenyl)diazenyl]naphthalen-2-ol.
| Compound Name | 1-[(2,3,5,6-tetramethyl-4-phenyldiazenylphenyl)diazenyl]naphthalen-2-ol |
|---|---|
| PubChem CID | 135977813 |
| Molecular Formula | C26H24N4O |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | 1-[(2,3,5,6-tetramethyl-4-phenyldiazenylphenyl)diazenyl]naphthalen-2-ol |
| SMILES | Cc1c(C)c(/N=N/c2c(O)ccc3ccccc23)c(C)c(C)c1/N=N/c1ccccc1 |
| InChI | InChI=1S/C26H24N4O/c1-16-18(3)25(19(4)17(2)24(16)28-27-21-11-6-5-7-12-21)29-30-26-22-13-9-8-10-20(22)14-15-23(26)31/h5-15,31H,1-4H3/b28-27+,30-29+ |
| InChIKey | FHOAKQRMMWPJSK-XOXGWFOHSA-N |
| XLogP | 8.61 |
| TPSA | 69.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|