C20H20N2O — CID 136629139
1-[(3-ethyl-4,5-dimethylphenyl)diazenyl]naphthalen-2-ol (PubChem CID 136629139) has the molecular formula C20H20N2O and a molecular weight of 304.39 g/mol. Its IUPAC name is 1-[(3-ethyl-4,5-dimethylphenyl)diazenyl]naphthalen-2-ol.
| Compound Name | 1-[(3-ethyl-4,5-dimethylphenyl)diazenyl]naphthalen-2-ol |
|---|---|
| PubChem CID | 136629139 |
| Molecular Formula | C20H20N2O |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | 1-[(3-ethyl-4,5-dimethylphenyl)diazenyl]naphthalen-2-ol |
| SMILES | CCc1cc(/N=N/c2c(O)ccc3ccccc23)cc(C)c1C |
| InChI | InChI=1S/C20H20N2O/c1-4-15-12-17(11-13(2)14(15)3)21-22-20-18-8-6-5-7-16(18)9-10-19(20)23/h5-12,23H,4H2,1-3H3/b22-21+ |
| InChIKey | KVTBNVZYRLEAQB-QURGRASLSA-N |
| XLogP | 6.14 |
| TPSA | 44.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|