C13H11N5O — CID 135588648
1-[(5-methyl-1H-1,2,4-triazol-3-yl)diazenyl]naphthalen-2-ol (PubChem CID 135588648) has the molecular formula C13H11N5O and a molecular weight of 253.27 g/mol. Its IUPAC name is 1-[(5-methyl-1H-1,2,4-triazol-3-yl)diazenyl]naphthalen-2-ol.
| Compound Name | 1-[(5-methyl-1H-1,2,4-triazol-3-yl)diazenyl]naphthalen-2-ol |
|---|---|
| PubChem CID | 135588648 |
| Molecular Formula | C13H11N5O |
| Molecular Weight | 253.27 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | 1-[(5-methyl-1H-1,2,4-triazol-3-yl)diazenyl]naphthalen-2-ol |
| SMILES | Cc1nc(/N=N/c2c(O)ccc3ccccc23)n[nH]1 |
| InChI | InChI=1S/C13H11N5O/c1-8-14-13(17-15-8)18-16-12-10-5-3-2-4-9(10)6-7-11(12)19/h2-7,19H,1H3,(H,14,15,17)/b18-16+ |
| InChIKey | VZDRFCQFMTWUFJ-FBMGVBCBSA-N |
| XLogP | 3.39 |
| TPSA | 86.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.27 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|