C15H14N4O — CID 136818473
1-[(1,3-dimethylpyrazol-4-yl)diazenyl]naphthalen-2-ol (PubChem CID 136818473) has the molecular formula C15H14N4O and a molecular weight of 266.30 g/mol. Its IUPAC name is 1-[(1,3-dimethylpyrazol-4-yl)diazenyl]naphthalen-2-ol.
| Compound Name | 1-[(1,3-dimethylpyrazol-4-yl)diazenyl]naphthalen-2-ol |
|---|---|
| PubChem CID | 136818473 |
| Molecular Formula | C15H14N4O |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 1-[(1,3-dimethylpyrazol-4-yl)diazenyl]naphthalen-2-ol |
| SMILES | Cc1nn(C)cc1/N=N/c1c(O)ccc2ccccc12 |
| InChI | InChI=1S/C15H14N4O/c1-10-13(9-19(2)18-10)16-17-15-12-6-4-3-5-11(12)7-8-14(15)20/h3-9,20H,1-2H3/b17-16+ |
| InChIKey | AAZXRCVURXJHNW-WUKNDPDISA-N |
| XLogP | 4.00 |
| TPSA | 62.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|