C21H18N4O2 — CID 135436621
2-[2-[(2-hydroxynaphthalen-1-yl)diazenyl]-4-methylphenyl]-3-methyl-1H-pyrazol-5-one (PubChem CID 135436621) has the molecular formula C21H18N4O2 and a molecular weight of 358.40 g/mol. Its IUPAC name is 2-[2-[(2-hydroxynaphthalen-1-yl)diazenyl]-4-methylphenyl]-3-methyl-1H-pyrazol-5-one.
| Compound Name | 2-[2-[(2-hydroxynaphthalen-1-yl)diazenyl]-4-methylphenyl]-3-methyl-1H-pyrazol-5-one |
|---|---|
| PubChem CID | 135436621 |
| Molecular Formula | C21H18N4O2 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | 2-[2-[(2-hydroxynaphthalen-1-yl)diazenyl]-4-methylphenyl]-3-methyl-1H-pyrazol-5-one |
| SMILES | Cc1ccc(-n2[nH]c(=O)cc2C)c(/N=N/c2c(O)ccc3ccccc23)c1 |
| InChI | InChI=1S/C21H18N4O2/c1-13-7-9-18(25-14(2)12-20(27)24-25)17(11-13)22-23-21-16-6-4-3-5-15(16)8-10-19(21)26/h3-12,26H,1-2H3,(H,24,27)/b23-22+ |
| InChIKey | FKSRJYYDFPRZRU-GHVJWSGMSA-N |
| XLogP | 5.06 |
| TPSA | 82.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|