C26H24N4O — CID 162511969
1-[[[4-(2,5-dimethylphenyl)-2,5-dimethylphenyl]diazenyl]diazenyl]naphthalen-2-ol (PubChem CID 162511969) has the molecular formula C26H24N4O and a molecular weight of 408.51 g/mol. Its IUPAC name is 1-[[[4-(2,5-dimethylphenyl)-2,5-dimethylphenyl]diazenyl]diazenyl]naphthalen-2-ol.
| Compound Name | 1-[[[4-(2,5-dimethylphenyl)-2,5-dimethylphenyl]diazenyl]diazenyl]naphthalen-2-ol |
|---|---|
| PubChem CID | 162511969 |
| Molecular Formula | C26H24N4O |
| Molecular Weight | 408.51 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | 1-[[[4-(2,5-dimethylphenyl)-2,5-dimethylphenyl]diazenyl]diazenyl]naphthalen-2-ol |
| SMILES | Cc1ccc(C)c(-c2cc(C)c(/N=N/N=N/c3c(O)ccc4ccccc34)cc2C)c1 |
| InChI | InChI=1S/C26H24N4O/c1-16-9-10-17(2)22(13-16)23-14-19(4)24(15-18(23)3)27-29-30-28-26-21-8-6-5-7-20(21)11-12-25(26)31/h5-15,31H,1-4H3/b29-27+,30-28+ |
| InChIKey | PWGIANAHEMKARU-QAVVBOBSSA-N |
| XLogP | 8.23 |
| TPSA | 69.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.51 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|