C16H11N5O — CID 135697160
1-(2H-pyrazolo[3,4-b]pyridin-3-yldiazenyl)naphthalen-2-ol (PubChem CID 135697160) has the molecular formula C16H11N5O and a molecular weight of 289.30 g/mol. Its IUPAC name is 1-(2H-pyrazolo[3,4-b]pyridin-3-yldiazenyl)naphthalen-2-ol.
| Compound Name | 1-(2H-pyrazolo[3,4-b]pyridin-3-yldiazenyl)naphthalen-2-ol |
|---|---|
| PubChem CID | 135697160 |
| Molecular Formula | C16H11N5O |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | 1-(2H-pyrazolo[3,4-b]pyridin-3-yldiazenyl)naphthalen-2-ol |
| SMILES | Oc1ccc2ccccc2c1/N=N/c1[nH]nc2ncccc12 |
| InChI | InChI=1S/C16H11N5O/c22-13-8-7-10-4-1-2-5-11(10)14(13)18-20-16-12-6-3-9-17-15(12)19-21-16/h1-9,22H,(H,17,19,21)/b20-18+ |
| InChIKey | IZLOSTMHJIYYMC-CZIZESTLSA-N |
| XLogP | 4.23 |
| TPSA | 86.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|