C15H10N6O — CID 146350466
1-(7H-purin-6-yldiazenyl)naphthalen-2-ol (PubChem CID 146350466) has the molecular formula C15H10N6O and a molecular weight of 290.29 g/mol. Its IUPAC name is 1-(7H-purin-6-yldiazenyl)naphthalen-2-ol.
| Compound Name | 1-(7H-purin-6-yldiazenyl)naphthalen-2-ol |
|---|---|
| PubChem CID | 146350466 |
| Molecular Formula | C15H10N6O |
| Molecular Weight | 290.29 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 1-(7H-purin-6-yldiazenyl)naphthalen-2-ol |
| SMILES | Oc1ccc2ccccc2c1/N=N/c1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C15H10N6O/c22-11-6-5-9-3-1-2-4-10(9)12(11)20-21-15-13-14(17-7-16-13)18-8-19-15/h1-8,22H,(H,16,17,18,19)/b21-20+ |
| InChIKey | HMSVAPFAKCWQHZ-QZQOTICOSA-N |
| XLogP | 3.63 |
| TPSA | 99.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.29 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|