C23H19N5O2 — CID 132547241
1-[(2-methoxyphenyl)-(7H-purin-6-ylamino)methyl]naphthalen-2-ol (PubChem CID 132547241) has the molecular formula C23H19N5O2 and a molecular weight of 397.44 g/mol. Its IUPAC name is 1-[(2-methoxyphenyl)-(7H-purin-6-ylamino)methyl]naphthalen-2-ol.
| Compound Name | 1-[(2-methoxyphenyl)-(7H-purin-6-ylamino)methyl]naphthalen-2-ol |
|---|---|
| PubChem CID | 132547241 |
| Molecular Formula | C23H19N5O2 |
| Molecular Weight | 397.44 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | 1-[(2-methoxyphenyl)-(7H-purin-6-ylamino)methyl]naphthalen-2-ol |
| SMILES | COc1ccccc1C(Nc1ncnc2nc[nH]c12)c1c(O)ccc2ccccc12 |
| InChI | InChI=1S/C23H19N5O2/c1-30-18-9-5-4-8-16(18)20(28-23-21-22(25-12-24-21)26-13-27-23)19-15-7-3-2-6-14(15)10-11-17(19)29/h2-13,20,29H,1H3,(H2,24,25,26,27,28) |
| InChIKey | ODAADHIVMOERCS-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 95.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.44 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|