C17H17N5O5 — CID 154759303
[1-oxo-1-(7H-purin-6-ylamino)propan-2-yl] 2,6-dimethoxybenzoate (PubChem CID 154759303) has the molecular formula C17H17N5O5 and a molecular weight of 371.35 g/mol. Its IUPAC name is [1-oxo-1-(7H-purin-6-ylamino)propan-2-yl] 2,6-dimethoxybenzoate.
| Compound Name | [1-oxo-1-(7H-purin-6-ylamino)propan-2-yl] 2,6-dimethoxybenzoate |
|---|---|
| PubChem CID | 154759303 |
| Molecular Formula | C17H17N5O5 |
| Molecular Weight | 371.35 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | [1-oxo-1-(7H-purin-6-ylamino)propan-2-yl] 2,6-dimethoxybenzoate |
| SMILES | COc1cccc(OC)c1C(=O)OC(C)C(=O)Nc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C17H17N5O5/c1-9(16(23)22-15-13-14(19-7-18-13)20-8-21-15)27-17(24)12-10(25-2)5-4-6-11(12)26-3/h4-9H,1-3H3,(H2,18,19,20,21,22,23) |
| InChIKey | IVKNCZMNQLESKZ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 128.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.35 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |