C20H20N6O4 — CID 24584976
[1-oxo-1-(7H-purin-6-ylamino)propan-2-yl] 4-[(2-oxopyrrolidin-1-yl)methyl]benzoate (PubChem CID 24584976) has the molecular formula C20H20N6O4 and a molecular weight of 408.42 g/mol. Its IUPAC name is [1-oxo-1-(7H-purin-6-ylamino)propan-2-yl] 4-[(2-oxopyrrolidin-1-yl)methyl]benzoate.
| Compound Name | [1-oxo-1-(7H-purin-6-ylamino)propan-2-yl] 4-[(2-oxopyrrolidin-1-yl)methyl]benzoate |
|---|---|
| PubChem CID | 24584976 |
| Molecular Formula | C20H20N6O4 |
| Molecular Weight | 408.42 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | [1-oxo-1-(7H-purin-6-ylamino)propan-2-yl] 4-[(2-oxopyrrolidin-1-yl)methyl]benzoate |
| SMILES | CC(OC(=O)c1ccc(CN2CCCC2=O)cc1)C(=O)Nc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C20H20N6O4/c1-12(19(28)25-18-16-17(22-10-21-16)23-11-24-18)30-20(29)14-6-4-13(5-7-14)9-26-8-2-3-15(26)27/h4-7,10-12H,2-3,8-9H2,1H3,(H2,21,22,23,24,25,28) |
| InChIKey | DLZGSQLWQIBBNW-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 130.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.42 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |