C16H13Cl2N5O3 — CID 24573239
[1-oxo-1-(7H-purin-6-ylamino)propan-2-yl] 2-(2,6-dichlorophenyl)acetate (PubChem CID 24573239) has the molecular formula C16H13Cl2N5O3 and a molecular weight of 394.22 g/mol. Its IUPAC name is [1-oxo-1-(7H-purin-6-ylamino)propan-2-yl] 2-(2,6-dichlorophenyl)acetate.
| Compound Name | [1-oxo-1-(7H-purin-6-ylamino)propan-2-yl] 2-(2,6-dichlorophenyl)acetate |
|---|---|
| PubChem CID | 24573239 |
| Molecular Formula | C16H13Cl2N5O3 |
| Molecular Weight | 394.22 g/mol |
| Exact Mass | 393.04 |
| IUPAC Name | [1-oxo-1-(7H-purin-6-ylamino)propan-2-yl] 2-(2,6-dichlorophenyl)acetate |
| SMILES | CC(OC(=O)Cc1c(Cl)cccc1Cl)C(=O)Nc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C16H13Cl2N5O3/c1-8(26-12(24)5-9-10(17)3-2-4-11(9)18)16(25)23-15-13-14(20-6-19-13)21-7-22-15/h2-4,6-8H,5H2,1H3,(H2,19,20,21,22,23,25) |
| InChIKey | OFSDQMSHMGWENI-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 109.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.22 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |