C18H14FN5O4 — CID 42894485
[1-oxo-1-(7H-purin-6-ylamino)propan-2-yl] 7-fluoro-3-methyl-1-benzofuran-2-carboxylate (PubChem CID 42894485) has the molecular formula C18H14FN5O4 and a molecular weight of 383.34 g/mol. Its IUPAC name is [1-oxo-1-(7H-purin-6-ylamino)propan-2-yl] 7-fluoro-3-methyl-1-benzofuran-2-carboxylate.
| Compound Name | [1-oxo-1-(7H-purin-6-ylamino)propan-2-yl] 7-fluoro-3-methyl-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 42894485 |
| Molecular Formula | C18H14FN5O4 |
| Molecular Weight | 383.34 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | [1-oxo-1-(7H-purin-6-ylamino)propan-2-yl] 7-fluoro-3-methyl-1-benzofuran-2-carboxylate |
| SMILES | Cc1c(C(=O)OC(C)C(=O)Nc2ncnc3nc[nH]c23)oc2c(F)cccc12 |
| InChI | InChI=1S/C18H14FN5O4/c1-8-10-4-3-5-11(19)14(10)28-13(8)18(26)27-9(2)17(25)24-16-12-15(21-6-20-12)22-7-23-16/h3-7,9H,1-2H3,(H2,20,21,22,23,24,25) |
| InChIKey | HSGLAKLZALLIJY-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 123.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.34 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |