C13H10FNO3 — CID 40766477
[(1S)-1-cyanoethyl] 7-fluoro-3-methyl-1-benzofuran-2-carboxylate (PubChem CID 40766477) has the molecular formula C13H10FNO3 and a molecular weight of 247.22 g/mol. Its IUPAC name is [(1S)-1-cyanoethyl] 7-fluoro-3-methyl-1-benzofuran-2-carboxylate.
| Compound Name | [(1S)-1-cyanoethyl] 7-fluoro-3-methyl-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 40766477 |
| Molecular Formula | C13H10FNO3 |
| Molecular Weight | 247.22 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | [(1S)-1-cyanoethyl] 7-fluoro-3-methyl-1-benzofuran-2-carboxylate |
| SMILES | Cc1c(C(=O)O[C@@H](C)C#N)oc2c(F)cccc12 |
| InChI | InChI=1S/C13H10FNO3/c1-7(6-15)17-13(16)11-8(2)9-4-3-5-10(14)12(9)18-11/h3-5,7H,1-2H3/t7-/m0/s1 |
| InChIKey | OYAMTUFESGEJBG-ZETCQYMHSA-N |
| XLogP | 2.95 |
| TPSA | 63.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.22 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |