C16H12FNO3 — CID 43021599
pyridin-2-ylmethyl 7-fluoro-3-methyl-1-benzofuran-2-carboxylate (PubChem CID 43021599) has the molecular formula C16H12FNO3 and a molecular weight of 285.27 g/mol. Its IUPAC name is pyridin-2-ylmethyl 7-fluoro-3-methyl-1-benzofuran-2-carboxylate.
| Compound Name | pyridin-2-ylmethyl 7-fluoro-3-methyl-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 43021599 |
| Molecular Formula | C16H12FNO3 |
| Molecular Weight | 285.27 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | pyridin-2-ylmethyl 7-fluoro-3-methyl-1-benzofuran-2-carboxylate |
| SMILES | Cc1c(C(=O)OCc2ccccn2)oc2c(F)cccc12 |
| InChI | InChI=1S/C16H12FNO3/c1-10-12-6-4-7-13(17)15(12)21-14(10)16(19)20-9-11-5-2-3-8-18-11/h2-8H,9H2,1H3 |
| InChIKey | HCNKWZPQAXZJLN-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.27 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |