C17H13FO4S — CID 8506393
[2-(5-methylthiophen-2-yl)-2-oxoethyl] 7-fluoro-3-methyl-1-benzofuran-2-carboxylate (PubChem CID 8506393) has the molecular formula C17H13FO4S and a molecular weight of 332.35 g/mol. Its IUPAC name is [2-(5-methylthiophen-2-yl)-2-oxoethyl] 7-fluoro-3-methyl-1-benzofuran-2-carboxylate.
| Compound Name | [2-(5-methylthiophen-2-yl)-2-oxoethyl] 7-fluoro-3-methyl-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 8506393 |
| Molecular Formula | C17H13FO4S |
| Molecular Weight | 332.35 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | [2-(5-methylthiophen-2-yl)-2-oxoethyl] 7-fluoro-3-methyl-1-benzofuran-2-carboxylate |
| SMILES | Cc1ccc(C(=O)COC(=O)c2oc3c(F)cccc3c2C)s1 |
| InChI | InChI=1S/C17H13FO4S/c1-9-6-7-14(23-9)13(19)8-21-17(20)15-10(2)11-4-3-5-12(18)16(11)22-15/h3-7H,8H2,1-2H3 |
| InChIKey | XXANHVGEJSGUOB-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.35 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |