C11H10FNO2 — CID 17459181
7-fluoro-N,3-dimethyl-1-benzofuran-2-carboxamide (PubChem CID 17459181) has the molecular formula C11H10FNO2 and a molecular weight of 207.20 g/mol. Its IUPAC name is 7-fluoro-N,3-dimethyl-1-benzofuran-2-carboxamide.
| Compound Name | 7-fluoro-N,3-dimethyl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 17459181 |
| Molecular Formula | C11H10FNO2 |
| Molecular Weight | 207.20 g/mol |
| Exact Mass | 207.07 |
| IUPAC Name | 7-fluoro-N,3-dimethyl-1-benzofuran-2-carboxamide |
| SMILES | CNC(=O)c1oc2c(F)cccc2c1C |
| InChI | InChI=1S/C11H10FNO2/c1-6-7-4-3-5-8(12)10(7)15-9(6)11(14)13-2/h3-5H,1-2H3,(H,13,14) |
| InChIKey | QYHXUCYAHVQCEE-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.20 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |