C13H11BrFNO2 — CID 47439011
N-(2-bromoprop-2-enyl)-7-fluoro-3-methyl-1-benzofuran-2-carboxamide (PubChem CID 47439011) has the molecular formula C13H11BrFNO2 and a molecular weight of 312.14 g/mol. Its IUPAC name is N-(2-bromoprop-2-enyl)-7-fluoro-3-methyl-1-benzofuran-2-carboxamide.
| Compound Name | N-(2-bromoprop-2-enyl)-7-fluoro-3-methyl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 47439011 |
| Molecular Formula | C13H11BrFNO2 |
| Molecular Weight | 312.14 g/mol |
| Exact Mass | 311.00 |
| IUPAC Name | N-(2-bromoprop-2-enyl)-7-fluoro-3-methyl-1-benzofuran-2-carboxamide |
| SMILES | C=C(Br)CNC(=O)c1oc2c(F)cccc2c1C |
| InChI | InChI=1S/C13H11BrFNO2/c1-7(14)6-16-13(17)11-8(2)9-4-3-5-10(15)12(9)18-11/h3-5H,1,6H2,2H3,(H,16,17) |
| InChIKey | SICWYQFVBQNCQP-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.14 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |