C15H12FNO2S — CID 9442142
7-fluoro-3-methyl-N-(thiophen-2-ylmethyl)-1-benzofuran-2-carboxamide (PubChem CID 9442142) has the molecular formula C15H12FNO2S and a molecular weight of 289.33 g/mol. Its IUPAC name is 7-fluoro-3-methyl-N-(thiophen-2-ylmethyl)-1-benzofuran-2-carboxamide.
| Compound Name | 7-fluoro-3-methyl-N-(thiophen-2-ylmethyl)-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 9442142 |
| Molecular Formula | C15H12FNO2S |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | 7-fluoro-3-methyl-N-(thiophen-2-ylmethyl)-1-benzofuran-2-carboxamide |
| SMILES | Cc1c(C(=O)NCc2cccs2)oc2c(F)cccc12 |
| InChI | InChI=1S/C15H12FNO2S/c1-9-11-5-2-6-12(16)14(11)19-13(9)15(18)17-8-10-4-3-7-20-10/h2-7H,8H2,1H3,(H,17,18) |
| InChIKey | PXVJFILVHWICJA-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |