C16H12FNO3 — CID 46665379
7-fluoro-N-(2-hydroxyphenyl)-3-methyl-1-benzofuran-2-carboxamide (PubChem CID 46665379) has the molecular formula C16H12FNO3 and a molecular weight of 285.27 g/mol. Its IUPAC name is 7-fluoro-N-(2-hydroxyphenyl)-3-methyl-1-benzofuran-2-carboxamide.
| Compound Name | 7-fluoro-N-(2-hydroxyphenyl)-3-methyl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 46665379 |
| Molecular Formula | C16H12FNO3 |
| Molecular Weight | 285.27 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | 7-fluoro-N-(2-hydroxyphenyl)-3-methyl-1-benzofuran-2-carboxamide |
| SMILES | Cc1c(C(=O)Nc2ccccc2O)oc2c(F)cccc12 |
| InChI | InChI=1S/C16H12FNO3/c1-9-10-5-4-6-11(17)15(10)21-14(9)16(20)18-12-7-2-3-8-13(12)19/h2-8,19H,1H3,(H,18,20) |
| InChIKey | KYAIPFJWHMYWKE-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.27 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|