C13H12FNO5 — CID 107832842
(2S)-3-[(7-fluoro-3-methyl-1-benzofuran-2-carbonyl)amino]-2-hydroxypropanoic acid (PubChem CID 107832842) has the molecular formula C13H12FNO5 and a molecular weight of 281.24 g/mol. Its IUPAC name is (2S)-3-[(7-fluoro-3-methyl-1-benzofuran-2-carbonyl)amino]-2-hydroxypropanoic acid.
| Compound Name | (2S)-3-[(7-fluoro-3-methyl-1-benzofuran-2-carbonyl)amino]-2-hydroxypropanoic acid |
|---|---|
| PubChem CID | 107832842 |
| Molecular Formula | C13H12FNO5 |
| Molecular Weight | 281.24 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | (2S)-3-[(7-fluoro-3-methyl-1-benzofuran-2-carbonyl)amino]-2-hydroxypropanoic acid |
| SMILES | Cc1c(C(=O)NC[C@H](O)C(=O)O)oc2c(F)cccc12 |
| InChI | InChI=1S/C13H12FNO5/c1-6-7-3-2-4-8(14)11(7)20-10(6)12(17)15-5-9(16)13(18)19/h2-4,9,16H,5H2,1H3,(H,15,17)(H,18,19)/t9-/m0/s1 |
| InChIKey | UPPAVHCSVCAKNL-VIFPVBQESA-N |
| XLogP | 1.06 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.24 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |