C15H16FN3O4 — CID 8532125
2-[2-(7-fluoro-3-methyl-1-benzofuran-2-carbonyl)hydrazinyl]-2-oxo-N-propan-2-ylacetamide (PubChem CID 8532125) has the molecular formula C15H16FN3O4 and a molecular weight of 321.31 g/mol. Its IUPAC name is 2-[2-(7-fluoro-3-methyl-1-benzofuran-2-carbonyl)hydrazinyl]-2-oxo-N-propan-2-ylacetamide.
| Compound Name | 2-[2-(7-fluoro-3-methyl-1-benzofuran-2-carbonyl)hydrazinyl]-2-oxo-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 8532125 |
| Molecular Formula | C15H16FN3O4 |
| Molecular Weight | 321.31 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 2-[2-(7-fluoro-3-methyl-1-benzofuran-2-carbonyl)hydrazinyl]-2-oxo-N-propan-2-ylacetamide |
| SMILES | Cc1c(C(=O)NNC(=O)C(=O)NC(C)C)oc2c(F)cccc12 |
| InChI | InChI=1S/C15H16FN3O4/c1-7(2)17-14(21)15(22)19-18-13(20)11-8(3)9-5-4-6-10(16)12(9)23-11/h4-7H,1-3H3,(H,17,21)(H,18,20)(H,19,22) |
| InChIKey | PDZQKQQYJQTCST-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 100.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.31 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|